C31H22O9 — CID 125122756
4-[5-[(10R)-3-(3,4-dimethoxyphenyl)-4,8-dioxo-9,10-dihydropyrano[2,3-f]chromen-10-yl]furan-2-yl]benzoic acid (PubChem CID 125122756) has the molecular formula C31H22O9 and a molecular weight of 538.51 g/mol. Its IUPAC name is 4-[5-[(10R)-3-(3,4-dimethoxyphenyl)-4,8-dioxo-9,10-dihydropyrano[2,3-f]chromen-10-yl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[(10R)-3-(3,4-dimethoxyphenyl)-4,8-dioxo-9,10-dihydropyrano[2,3-f]chromen-10-yl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 125122756 |
| Molecular Formula | C31H22O9 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 4-[5-[(10R)-3-(3,4-dimethoxyphenyl)-4,8-dioxo-9,10-dihydropyrano[2,3-f]chromen-10-yl]furan-2-yl]benzoic acid |
| SMILES | COc1ccc(-c2coc3c4c(ccc3c2=O)OC(=O)C[C@H]4c2ccc(-c3ccc(C(=O)O)cc3)o2)cc1OC |
| InChI | InChI=1S/C31H22O9/c1-36-24-9-7-18(13-26(24)37-2)21-15-38-30-19(29(21)33)8-10-25-28(30)20(14-27(32)40-25)23-12-11-22(39-23)16-3-5-17(6-4-16)31(34)35/h3-13,15,20H,14H2,1-2H3,(H,34,35)/t20-/m0/s1 |
| InChIKey | OQANKTWSGPYURN-FQEVSTJZSA-N |
| XLogP | 5.88 |
| TPSA | 125.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|