C17H20O6 — CID 156580887
methyl 5-(5,7-dimethoxy-4-oxochromen-2-yl)pentanoate (PubChem CID 156580887) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is methyl 5-(5,7-dimethoxy-4-oxochromen-2-yl)pentanoate.
| Compound Name | methyl 5-(5,7-dimethoxy-4-oxochromen-2-yl)pentanoate |
|---|---|
| PubChem CID | 156580887 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | methyl 5-(5,7-dimethoxy-4-oxochromen-2-yl)pentanoate |
| SMILES | COC(=O)CCCCc1cc(=O)c2c(OC)cc(OC)cc2o1 |
| InChI | InChI=1S/C17H20O6/c1-20-12-9-14(21-2)17-13(18)8-11(23-15(17)10-12)6-4-5-7-16(19)22-3/h8-10H,4-7H2,1-3H3 |
| InChIKey | JABBUGZGEVJIJX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|