C21H33ClN4O2 — CID 144714247
2-aminoethyl N-[4-[(7-chloroquinolin-4-yl)amino]pentyl]carbamate;ethane;ethene (PubChem CID 144714247) has the molecular formula C21H33ClN4O2 and a molecular weight of 408.97 g/mol. Its IUPAC name is 2-aminoethyl N-[4-[(7-chloroquinolin-4-yl)amino]pentyl]carbamate;ethane;ethene.
| Compound Name | 2-aminoethyl N-[4-[(7-chloroquinolin-4-yl)amino]pentyl]carbamate;ethane;ethene |
|---|---|
| PubChem CID | 144714247 |
| Molecular Formula | C21H33ClN4O2 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 2-aminoethyl N-[4-[(7-chloroquinolin-4-yl)amino]pentyl]carbamate;ethane;ethene |
| SMILES | C=C.CC.CC(CCCNC(=O)OCCN)Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C17H23ClN4O2.C2H6.C2H4/c1-12(3-2-8-21-17(23)24-10-7-19)22-15-6-9-20-16-11-13(18)4-5-14(15)16;2*1-2/h4-6,9,11-12H,2-3,7-8,10,19H2,1H3,(H,20,22)(H,21,23);1-2H3;1-2H2 |
| InChIKey | KSPIPTQAKMPSCQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|