C18H28N4 — CID 129362155
4-N-[(2S)-5-(diethylamino)pentan-2-yl]quinoline-4,6-diamine (PubChem CID 129362155) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is 4-N-[(2S)-5-(diethylamino)pentan-2-yl]quinoline-4,6-diamine.
| Compound Name | 4-N-[(2S)-5-(diethylamino)pentan-2-yl]quinoline-4,6-diamine |
|---|---|
| PubChem CID | 129362155 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 4-N-[(2S)-5-(diethylamino)pentan-2-yl]quinoline-4,6-diamine |
| SMILES | CCN(CC)CCC[C@H](C)Nc1ccnc2ccc(N)cc12 |
| InChI | InChI=1S/C18H28N4/c1-4-22(5-2)12-6-7-14(3)21-18-10-11-20-17-9-8-15(19)13-16(17)18/h8-11,13-14H,4-7,12,19H2,1-3H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | VDWMFSBLEFTMJG-AWEZNQCLSA-N |
| XLogP | 3.74 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|