C27H36ClN5O4 — CID 162655760
tert-butyl N-[1-[(E)-4-[4-[(7-chloroquinolin-4-yl)amino]butylamino]-4-oxobut-2-enoyl]piperidin-4-yl]carbamate (PubChem CID 162655760) has the molecular formula C27H36ClN5O4 and a molecular weight of 530.07 g/mol. Its IUPAC name is tert-butyl N-[1-[(E)-4-[4-[(7-chloroquinolin-4-yl)amino]butylamino]-4-oxobut-2-enoyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(E)-4-[4-[(7-chloroquinolin-4-yl)amino]butylamino]-4-oxobut-2-enoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 162655760 |
| Molecular Formula | C27H36ClN5O4 |
| Molecular Weight | 530.07 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | tert-butyl N-[1-[(E)-4-[4-[(7-chloroquinolin-4-yl)amino]butylamino]-4-oxobut-2-enoyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)/C=C/C(=O)NCCCCNc2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C27H36ClN5O4/c1-27(2,3)37-26(36)32-20-11-16-33(17-12-20)25(35)9-8-24(34)31-14-5-4-13-29-22-10-15-30-23-18-19(28)6-7-21(22)23/h6-10,15,18,20H,4-5,11-14,16-17H2,1-3H3,(H,29,30)(H,31,34)(H,32,36)/b9-8+ |
| InChIKey | DCJRCYJMEXRSCJ-CMDGGOBGSA-N |
| XLogP | 4.27 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.07 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|