C26H38ClN5O5 — CID 44544673
tert-butyl N-[1-[3-[(7-chloroquinolin-4-yl)amino]propylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 44544673) has the molecular formula C26H38ClN5O5 and a molecular weight of 536.07 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[(7-chloroquinolin-4-yl)amino]propylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[(7-chloroquinolin-4-yl)amino]propylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 44544673 |
| Molecular Formula | C26H38ClN5O5 |
| Molecular Weight | 536.07 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | tert-butyl N-[1-[3-[(7-chloroquinolin-4-yl)amino]propylamino]-6-(ethoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | CCOC(=O)NCCCCC(NC(=O)OC(C)(C)C)C(=O)NCCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C26H38ClN5O5/c1-5-36-24(34)31-13-7-6-9-21(32-25(35)37-26(2,3)4)23(33)30-15-8-14-28-20-12-16-29-22-17-18(27)10-11-19(20)22/h10-12,16-17,21H,5-9,13-15H2,1-4H3,(H,28,29)(H,30,33)(H,31,34)(H,32,35) |
| InChIKey | DTHOBXPISCLWJM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 130.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.07 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|