C20H23Cl2N3O — CID 11847123
N'-[(5-chlorofuran-2-yl)methyl]-N-(7-chloroquinolin-4-yl)-N'-propylpropane-1,3-diamine (PubChem CID 11847123) has the molecular formula C20H23Cl2N3O and a molecular weight of 392.33 g/mol. Its IUPAC name is N'-[(5-chlorofuran-2-yl)methyl]-N-(7-chloroquinolin-4-yl)-N'-propylpropane-1,3-diamine.
| Compound Name | N'-[(5-chlorofuran-2-yl)methyl]-N-(7-chloroquinolin-4-yl)-N'-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 11847123 |
| Molecular Formula | C20H23Cl2N3O |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N'-[(5-chlorofuran-2-yl)methyl]-N-(7-chloroquinolin-4-yl)-N'-propylpropane-1,3-diamine |
| SMILES | CCCN(CCCNc1ccnc2cc(Cl)ccc12)Cc1ccc(Cl)o1 |
| InChI | InChI=1S/C20H23Cl2N3O/c1-2-11-25(14-16-5-7-20(22)26-16)12-3-9-23-18-8-10-24-19-13-15(21)4-6-17(18)19/h4-8,10,13H,2-3,9,11-12,14H2,1H3,(H,23,24) |
| InChIKey | UEWWRQJMVHQKJG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|