C22H25ClN4O3 — CID 11846809
2-[[3-[(7-chloroquinolin-4-yl)amino]propyl-propylamino]methyl]-6-nitrophenol (PubChem CID 11846809) has the molecular formula C22H25ClN4O3 and a molecular weight of 428.92 g/mol. Its IUPAC name is 2-[[3-[(7-chloroquinolin-4-yl)amino]propyl-propylamino]methyl]-6-nitrophenol.
| Compound Name | 2-[[3-[(7-chloroquinolin-4-yl)amino]propyl-propylamino]methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 11846809 |
| Molecular Formula | C22H25ClN4O3 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-[[3-[(7-chloroquinolin-4-yl)amino]propyl-propylamino]methyl]-6-nitrophenol |
| SMILES | CCCN(CCCNc1ccnc2cc(Cl)ccc12)Cc1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C22H25ClN4O3/c1-2-12-26(15-16-5-3-6-21(22(16)28)27(29)30)13-4-10-24-19-9-11-25-20-14-17(23)7-8-18(19)20/h3,5-9,11,14,28H,2,4,10,12-13,15H2,1H3,(H,24,25) |
| InChIKey | JRSMUIZHPAJJJR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 91.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|