C17H23N5O7 — CID 88828145
2-[3-[(7-methoxyquinolin-4-yl)amino]propyl-(2-nitrooxyethyl)amino]ethyl nitrate (PubChem CID 88828145) has the molecular formula C17H23N5O7 and a molecular weight of 409.40 g/mol. Its IUPAC name is 2-[3-[(7-methoxyquinolin-4-yl)amino]propyl-(2-nitrooxyethyl)amino]ethyl nitrate.
| Compound Name | 2-[3-[(7-methoxyquinolin-4-yl)amino]propyl-(2-nitrooxyethyl)amino]ethyl nitrate |
|---|---|
| PubChem CID | 88828145 |
| Molecular Formula | C17H23N5O7 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-[3-[(7-methoxyquinolin-4-yl)amino]propyl-(2-nitrooxyethyl)amino]ethyl nitrate |
| SMILES | COc1ccc2c(NCCCN(CCO[N+](=O)[O-])CCO[N+](=O)[O-])ccnc2c1 |
| InChI | InChI=1S/C17H23N5O7/c1-27-14-3-4-15-16(5-7-19-17(15)13-14)18-6-2-8-20(9-11-28-21(23)24)10-12-29-22(25)26/h3-5,7,13H,2,6,8-12H2,1H3,(H,18,19) |
| InChIKey | OGNKSQCVOARNRR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 142.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|