C25H31N5O15 — CID 88828144
bis((E)-but-2-enedioic acid);2-[3-[(7-methoxyquinolin-4-yl)amino]propyl-(2-nitrooxyethyl)amino]ethyl nitrate (PubChem CID 88828144) has the molecular formula C25H31N5O15 and a molecular weight of 641.54 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);2-[3-[(7-methoxyquinolin-4-yl)amino]propyl-(2-nitrooxyethyl)amino]ethyl nitrate.
| Compound Name | bis((E)-but-2-enedioic acid);2-[3-[(7-methoxyquinolin-4-yl)amino]propyl-(2-nitrooxyethyl)amino]ethyl nitrate |
|---|---|
| PubChem CID | 88828144 |
| Molecular Formula | C25H31N5O15 |
| Molecular Weight | 641.54 g/mol |
| Exact Mass | 641.18 |
| IUPAC Name | bis((E)-but-2-enedioic acid);2-[3-[(7-methoxyquinolin-4-yl)amino]propyl-(2-nitrooxyethyl)amino]ethyl nitrate |
| SMILES | COc1ccc2c(NCCCN(CCO[N+](=O)[O-])CCO[N+](=O)[O-])ccnc2c1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H23N5O7.2C4H4O4/c1-27-14-3-4-15-16(5-7-19-17(15)13-14)18-6-2-8-20(9-11-28-21(23)24)10-12-29-22(25)26;2*5-3(6)1-2-4(7)8/h3-5,7,13H,2,6,8-12H2,1H3,(H,18,19);2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | BHZCZFAWFQWTPT-LVEZLNDCSA-N |
| XLogP | 1.19 |
| TPSA | 291.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.54 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|