C15H14BrN3O2S2 — CID 133397399
N-[2-[(6-bromoquinolin-4-yl)amino]ethyl]thiophene-2-sulfonamide (PubChem CID 133397399) has the molecular formula C15H14BrN3O2S2 and a molecular weight of 412.33 g/mol. Its IUPAC name is N-[2-[(6-bromoquinolin-4-yl)amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[(6-bromoquinolin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133397399 |
| Molecular Formula | C15H14BrN3O2S2 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | N-[2-[(6-bromoquinolin-4-yl)amino]ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCNc1ccnc2ccc(Br)cc12)c1cccs1 |
| InChI | InChI=1S/C15H14BrN3O2S2/c16-11-3-4-13-12(10-11)14(5-6-17-13)18-7-8-19-23(20,21)15-2-1-9-22-15/h1-6,9-10,19H,7-8H2,(H,17,18) |
| InChIKey | BEMPWMFLQMIUOJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|