C16H15F3N6O2 — CID 56655655
N-[4-(3-nitro-1,2,4-triazol-1-yl)butyl]-7-(trifluoromethyl)quinolin-4-amine (PubChem CID 56655655) has the molecular formula C16H15F3N6O2 and a molecular weight of 380.33 g/mol. Its IUPAC name is N-[4-(3-nitro-1,2,4-triazol-1-yl)butyl]-7-(trifluoromethyl)quinolin-4-amine.
| Compound Name | N-[4-(3-nitro-1,2,4-triazol-1-yl)butyl]-7-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 56655655 |
| Molecular Formula | C16H15F3N6O2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[4-(3-nitro-1,2,4-triazol-1-yl)butyl]-7-(trifluoromethyl)quinolin-4-amine |
| SMILES | O=[N+]([O-])c1ncn(CCCCNc2ccnc3cc(C(F)(F)F)ccc23)n1 |
| InChI | InChI=1S/C16H15F3N6O2/c17-16(18,19)11-3-4-12-13(5-7-21-14(12)9-11)20-6-1-2-8-24-10-22-15(23-24)25(26)27/h3-5,7,9-10H,1-2,6,8H2,(H,20,21) |
| InChIKey | YSHGUYZQIDZXIA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|