C20H21N5O5 — CID 175539351
tert-butyl 1-[4-[methoxy(2-oxoethyl)carbamoyl]quinolin-6-yl]triazole-4-carboxylate (PubChem CID 175539351) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is tert-butyl 1-[4-[methoxy(2-oxoethyl)carbamoyl]quinolin-6-yl]triazole-4-carboxylate.
| Compound Name | tert-butyl 1-[4-[methoxy(2-oxoethyl)carbamoyl]quinolin-6-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 175539351 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | tert-butyl 1-[4-[methoxy(2-oxoethyl)carbamoyl]quinolin-6-yl]triazole-4-carboxylate |
| SMILES | CON(CC=O)C(=O)c1ccnc2ccc(-n3cc(C(=O)OC(C)(C)C)nn3)cc12 |
| InChI | InChI=1S/C20H21N5O5/c1-20(2,3)30-19(28)17-12-24(23-22-17)13-5-6-16-15(11-13)14(7-8-21-16)18(27)25(29-4)9-10-26/h5-8,10-12H,9H2,1-4H3 |
| InChIKey | DCNLJUIQMZZJHY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 116.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|