C19H24N2O3 — CID 164532532
tert-butyl 6-[(3R)-3-methylmorpholin-4-yl]quinoline-4-carboxylate (PubChem CID 164532532) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl 6-[(3R)-3-methylmorpholin-4-yl]quinoline-4-carboxylate.
| Compound Name | tert-butyl 6-[(3R)-3-methylmorpholin-4-yl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 164532532 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | tert-butyl 6-[(3R)-3-methylmorpholin-4-yl]quinoline-4-carboxylate |
| SMILES | C[C@@H]1COCCN1c1ccc2nccc(C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C19H24N2O3/c1-13-12-23-10-9-21(13)14-5-6-17-16(11-14)15(7-8-20-17)18(22)24-19(2,3)4/h5-8,11,13H,9-10,12H2,1-4H3/t13-/m1/s1 |
| InChIKey | CBTNFXOTRBKGFE-CYBMUJFWSA-N |
| XLogP | 3.42 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |