C21H28N2O3 — CID 167118358
tert-butyl 6-[(6-methyloxepan-3-yl)amino]quinoline-4-carboxylate (PubChem CID 167118358) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is tert-butyl 6-[(6-methyloxepan-3-yl)amino]quinoline-4-carboxylate.
| Compound Name | tert-butyl 6-[(6-methyloxepan-3-yl)amino]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 167118358 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | tert-butyl 6-[(6-methyloxepan-3-yl)amino]quinoline-4-carboxylate |
| SMILES | CC1CCC(Nc2ccc3nccc(C(=O)OC(C)(C)C)c3c2)COC1 |
| InChI | InChI=1S/C21H28N2O3/c1-14-5-6-16(13-25-12-14)23-15-7-8-19-18(11-15)17(9-10-22-19)20(24)26-21(2,3)4/h7-11,14,16,23H,5-6,12-13H2,1-4H3 |
| InChIKey | LDZSOKBXFQOTLE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |