C16H20N4O3 — CID 164870318
tert-butyl 3-[(4-oxo-3H-quinazolin-6-yl)amino]azetidine-1-carboxylate (PubChem CID 164870318) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is tert-butyl 3-[(4-oxo-3H-quinazolin-6-yl)amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-oxo-3H-quinazolin-6-yl)amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 164870318 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | tert-butyl 3-[(4-oxo-3H-quinazolin-6-yl)amino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Nc2ccc3nc[nH]c(=O)c3c2)C1 |
| InChI | InChI=1S/C16H20N4O3/c1-16(2,3)23-15(22)20-7-11(8-20)19-10-4-5-13-12(6-10)14(21)18-9-17-13/h4-6,9,11,19H,7-8H2,1-3H3,(H,17,18,21) |
| InChIKey | JWYIZGUORIPSMA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |