C20H28N4O4 — CID 164869876
tert-butyl 4-[(7-ethoxy-4-oxo-3H-quinazolin-6-yl)amino]piperidine-1-carboxylate (PubChem CID 164869876) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is tert-butyl 4-[(7-ethoxy-4-oxo-3H-quinazolin-6-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(7-ethoxy-4-oxo-3H-quinazolin-6-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164869876 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | tert-butyl 4-[(7-ethoxy-4-oxo-3H-quinazolin-6-yl)amino]piperidine-1-carboxylate |
| SMILES | CCOc1cc2nc[nH]c(=O)c2cc1NC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H28N4O4/c1-5-27-17-11-15-14(18(25)22-12-21-15)10-16(17)23-13-6-8-24(9-7-13)19(26)28-20(2,3)4/h10-13,23H,5-9H2,1-4H3,(H,21,22,25) |
| InChIKey | QZHPLAUPOHBLCD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |