C19H24N2O2 — CID 164532802
tert-butyl 6-[(2S)-2-methylpyrrolidin-1-yl]quinoline-4-carboxylate (PubChem CID 164532802) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is tert-butyl 6-[(2S)-2-methylpyrrolidin-1-yl]quinoline-4-carboxylate.
| Compound Name | tert-butyl 6-[(2S)-2-methylpyrrolidin-1-yl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 164532802 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | tert-butyl 6-[(2S)-2-methylpyrrolidin-1-yl]quinoline-4-carboxylate |
| SMILES | C[C@H]1CCCN1c1ccc2nccc(C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C19H24N2O2/c1-13-6-5-11-21(13)14-7-8-17-16(12-14)15(9-10-20-17)18(22)23-19(2,3)4/h7-10,12-13H,5-6,11H2,1-4H3/t13-/m0/s1 |
| InChIKey | KUAIGPJZKOFBBR-ZDUSSCGKSA-N |
| XLogP | 4.18 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |