C30H38F2N6O5 — CID 169041542
tert-butyl 4-[3-[4-[[2-[(2R)-5,5-difluoro-2-isocyanopiperidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-6-yl]oxypropyl]piperazine-1-carboxylate (PubChem CID 169041542) has the molecular formula C30H38F2N6O5 and a molecular weight of 600.67 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-[[2-[(2R)-5,5-difluoro-2-isocyanopiperidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-6-yl]oxypropyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-[[2-[(2R)-5,5-difluoro-2-isocyanopiperidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-6-yl]oxypropyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169041542 |
| Molecular Formula | C30H38F2N6O5 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | tert-butyl 4-[3-[4-[[2-[(2R)-5,5-difluoro-2-isocyanopiperidin-1-yl]-2-oxoethyl]carbamoyl]quinolin-6-yl]oxypropyl]piperazine-1-carboxylate |
| SMILES | [C-]#[N+][C@@H]1CCC(F)(F)CN1C(=O)CNC(=O)c1ccnc2ccc(OCCCN3CCN(C(=O)OC(C)(C)C)CC3)cc12 |
| InChI | InChI=1S/C30H38F2N6O5/c1-29(2,3)43-28(41)37-15-13-36(14-16-37)12-5-17-42-21-6-7-24-23(18-21)22(9-11-34-24)27(40)35-19-26(39)38-20-30(31,32)10-8-25(38)33-4/h6-7,9,11,18,25H,5,8,10,12-17,19-20H2,1-3H3,(H,35,40)/t25-/m0/s1 |
| InChIKey | SFPXIILKMABIML-VWLOTQADSA-N |
| XLogP | 3.79 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|