C23H28N3O3+ — CID 145421512
2-[(1,3-diethyl-5-methoxybenzimidazol-1-ium-2-yl)methyl]isoindole-1,3-dione;ethane (PubChem CID 145421512) has the molecular formula C23H28N3O3+ and a molecular weight of 394.50 g/mol. Its IUPAC name is 2-[(1,3-diethyl-5-methoxybenzimidazol-1-ium-2-yl)methyl]isoindole-1,3-dione;ethane.
| Compound Name | 2-[(1,3-diethyl-5-methoxybenzimidazol-1-ium-2-yl)methyl]isoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 145421512 |
| Molecular Formula | C23H28N3O3+ |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 2-[(1,3-diethyl-5-methoxybenzimidazol-1-ium-2-yl)methyl]isoindole-1,3-dione;ethane |
| SMILES | CC.CCn1c(CN2C(=O)c3ccccc3C2=O)[n+](CC)c2ccc(OC)cc21 |
| InChI | InChI=1S/C21H22N3O3.C2H6/c1-4-22-17-11-10-14(27-3)12-18(17)23(5-2)19(22)13-24-20(25)15-8-6-7-9-16(15)21(24)26;1-2/h6-12H,4-5,13H2,1-3H3;1-2H3/q+1; |
| InChIKey | YNJHQUTUNFNRDY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|