C30H27F3N3O8+ — CID 145120969
3-[[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-5-(2-hydroxyethoxy)benzimidazol-1-ium-1-yl]methyl]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 145120969) has the molecular formula C30H27F3N3O8+ and a molecular weight of 614.55 g/mol. Its IUPAC name is 3-[[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-5-(2-hydroxyethoxy)benzimidazol-1-ium-1-yl]methyl]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-5-(2-hydroxyethoxy)benzimidazol-1-ium-1-yl]methyl]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 145120969 |
| Molecular Formula | C30H27F3N3O8+ |
| Molecular Weight | 614.55 g/mol |
| Exact Mass | 614.17 |
| IUPAC Name | 3-[[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-5-(2-hydroxyethoxy)benzimidazol-1-ium-1-yl]methyl]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCn1c(CN2C(=O)c3ccccc3C2=O)[n+](Cc2cccc(C(=O)O)c2)c2ccc(OCCO)cc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H25N3O6.C2HF3O2/c1-2-29-24-15-20(37-13-12-32)10-11-23(24)30(16-18-6-5-7-19(14-18)28(35)36)25(29)17-31-26(33)21-8-3-4-9-22(21)27(31)34;3-2(4,5)1(6)7/h3-11,14-15,32H,2,12-13,16-17H2,1H3;(H,6,7)/p+1 |
| InChIKey | AFKVHMLOJWXZCN-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|