C24H19BrN2O4 — CID 55919971
N-[2-(3-bromophenoxy)ethyl]-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide (PubChem CID 55919971) has the molecular formula C24H19BrN2O4 and a molecular weight of 479.33 g/mol. Its IUPAC name is N-[2-(3-bromophenoxy)ethyl]-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide.
| Compound Name | N-[2-(3-bromophenoxy)ethyl]-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55919971 |
| Molecular Formula | C24H19BrN2O4 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | N-[2-(3-bromophenoxy)ethyl]-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide |
| SMILES | O=C(NCCOc1cccc(Br)c1)c1cccc(CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C24H19BrN2O4/c25-18-7-4-8-19(14-18)31-12-11-26-22(28)17-6-3-5-16(13-17)15-27-23(29)20-9-1-2-10-21(20)24(27)30/h1-10,13-14H,11-12,15H2,(H,26,28) |
| InChIKey | DAKCPYVDMLDVRJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|