C28H30F2N3O8+ — CID 130394691
3-[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]benzimidazol-1-ium-5-yl]oxy-2,2-difluorobut-3-enoic acid (PubChem CID 130394691) has the molecular formula C28H30F2N3O8+ and a molecular weight of 574.56 g/mol. Its IUPAC name is 3-[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]benzimidazol-1-ium-5-yl]oxy-2,2-difluorobut-3-enoic acid.
| Compound Name | 3-[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]benzimidazol-1-ium-5-yl]oxy-2,2-difluorobut-3-enoic acid |
|---|---|
| PubChem CID | 130394691 |
| Molecular Formula | C28H30F2N3O8+ |
| Molecular Weight | 574.56 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | 3-[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]benzimidazol-1-ium-5-yl]oxy-2,2-difluorobut-3-enoic acid |
| SMILES | C=C(Oc1ccc2c(c1)n(CC)c(CN1C(=O)c3ccccc3C1=O)[n+]2CCOCCOCCO)C(F)(F)C(=O)O |
| InChI | InChI=1S/C28H29F2N3O8/c1-3-31-23-16-19(41-18(2)28(29,30)27(37)38)8-9-22(23)32(10-12-39-14-15-40-13-11-34)24(31)17-33-25(35)20-6-4-5-7-21(20)26(33)36/h4-9,16,34H,2-3,10-15,17H2,1H3/p+1 |
| InChIKey | SIKSNKVVDYWZLS-UHFFFAOYSA-O |
| XLogP | 2.38 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|