C29H28BrN3O6 — CID 162308628
methyl 3-[[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-5-(2-hydroxyethoxy)benzimidazol-1-ium-1-yl]methyl]benzoate bromide (PubChem CID 162308628) has the molecular formula C29H28BrN3O6 and a molecular weight of 594.46 g/mol. Its IUPAC name is methyl 3-[[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-5-(2-hydroxyethoxy)benzimidazol-1-ium-1-yl]methyl]benzoate bromide.
| Compound Name | methyl 3-[[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-5-(2-hydroxyethoxy)benzimidazol-1-ium-1-yl]methyl]benzoate bromide |
|---|---|
| PubChem CID | 162308628 |
| Molecular Formula | C29H28BrN3O6 |
| Molecular Weight | 594.46 g/mol |
| Exact Mass | 593.12 |
| IUPAC Name | methyl 3-[[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-5-(2-hydroxyethoxy)benzimidazol-1-ium-1-yl]methyl]benzoate bromide |
| SMILES | CCn1c(CN2C(=O)c3ccccc3C2=O)[n+](Cc2cccc(C(=O)OC)c2)c2ccc(OCCO)cc21.[Br-] |
| InChI | InChI=1S/C29H28N3O6.BrH/c1-3-30-25-16-21(38-14-13-33)11-12-24(25)31(17-19-7-6-8-20(15-19)29(36)37-2)26(30)18-32-27(34)22-9-4-5-10-23(22)28(32)35;/h4-12,15-16,33H,3,13-14,17-18H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | OZNOAELDICGDTD-UHFFFAOYSA-M |
| XLogP | -0.05 |
| TPSA | 101.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.46 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|