C32H36N5O7+ — CID 122418563
1-[2-[2-[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-6-(2-hydroxyethoxy)benzimidazol-3-ium-1-yl]ethoxy]ethyl]-N,N-dimethyl-6-oxopyridine-3-carboxamide (PubChem CID 122418563) has the molecular formula C32H36N5O7+ and a molecular weight of 602.67 g/mol. Its IUPAC name is 1-[2-[2-[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-6-(2-hydroxyethoxy)benzimidazol-3-ium-1-yl]ethoxy]ethyl]-N,N-dimethyl-6-oxopyridine-3-carboxamide.
| Compound Name | 1-[2-[2-[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-6-(2-hydroxyethoxy)benzimidazol-3-ium-1-yl]ethoxy]ethyl]-N,N-dimethyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 122418563 |
| Molecular Formula | C32H36N5O7+ |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | 1-[2-[2-[2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-6-(2-hydroxyethoxy)benzimidazol-3-ium-1-yl]ethoxy]ethyl]-N,N-dimethyl-6-oxopyridine-3-carboxamide |
| SMILES | CC[n+]1c(CN2C(=O)c3ccccc3C2=O)n(CCOCCn2cc(C(=O)N(C)C)ccc2=O)c2cc(OCCO)ccc21 |
| InChI | InChI=1S/C32H36N5O7/c1-4-35-26-11-10-23(44-18-15-38)19-27(26)36(28(35)21-37-31(41)24-7-5-6-8-25(24)32(37)42)14-17-43-16-13-34-20-22(9-12-29(34)39)30(40)33(2)3/h5-12,19-20,38H,4,13-18,21H2,1-3H3/q+1 |
| InChIKey | QSPMIWUYLSUEHH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 127.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|