C10H13NO5 — CID 61071803
1-[2-(2-hydroxyethoxy)ethyl]-6-oxopyridine-3-carboxylic acid (PubChem CID 61071803) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethoxy)ethyl]-6-oxopyridine-3-carboxylic acid.
| Compound Name | 1-[2-(2-hydroxyethoxy)ethyl]-6-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 61071803 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethyl]-6-oxopyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(=O)n(CCOCCO)c1 |
| InChI | InChI=1S/C10H13NO5/c12-4-6-16-5-3-11-7-8(10(14)15)1-2-9(11)13/h1-2,7,12H,3-6H2,(H,14,15) |
| InChIKey | WNYSLINJULJMKW-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|