C12H17NO4 — CID 103034230
1-(3-methoxy-3-methylbutyl)-6-oxopyridine-3-carboxylic acid (PubChem CID 103034230) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 1-(3-methoxy-3-methylbutyl)-6-oxopyridine-3-carboxylic acid.
| Compound Name | 1-(3-methoxy-3-methylbutyl)-6-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 103034230 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 1-(3-methoxy-3-methylbutyl)-6-oxopyridine-3-carboxylic acid |
| SMILES | COC(C)(C)CCn1cc(C(=O)O)ccc1=O |
| InChI | InChI=1S/C12H17NO4/c1-12(2,17-3)6-7-13-8-9(11(15)16)4-5-10(13)14/h4-5,8H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | LBTCVMBONFEHON-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |