C20H17BrN2O3 — CID 21418184
2-[2-(2-methylisoquinolin-2-ium-6-yl)oxyethyl]isoindole-1,3-dione bromide (PubChem CID 21418184) has the molecular formula C20H17BrN2O3 and a molecular weight of 413.27 g/mol. Its IUPAC name is 2-[2-(2-methylisoquinolin-2-ium-6-yl)oxyethyl]isoindole-1,3-dione bromide.
| Compound Name | 2-[2-(2-methylisoquinolin-2-ium-6-yl)oxyethyl]isoindole-1,3-dione bromide |
|---|---|
| PubChem CID | 21418184 |
| Molecular Formula | C20H17BrN2O3 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 2-[2-(2-methylisoquinolin-2-ium-6-yl)oxyethyl]isoindole-1,3-dione bromide |
| SMILES | C[n+]1ccc2cc(OCCN3C(=O)c4ccccc4C3=O)ccc2c1.[Br-] |
| InChI | InChI=1S/C20H17N2O3.BrH/c1-21-9-8-14-12-16(7-6-15(14)13-21)25-11-10-22-19(23)17-4-2-3-5-18(17)20(22)24;/h2-9,12-13H,10-11H2,1H3;1H/q+1;/p-1 |
| InChIKey | XCWPJGKRBLGNEU-UHFFFAOYSA-M |
| XLogP | -0.66 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|