C26H30N3O6+ — CID 122417567
2-[[1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5-methoxy-3-prop-2-enylbenzimidazol-1-ium-2-yl]methyl]isoindole-1,3-dione (PubChem CID 122417567) has the molecular formula C26H30N3O6+ and a molecular weight of 480.54 g/mol. Its IUPAC name is 2-[[1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5-methoxy-3-prop-2-enylbenzimidazol-1-ium-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5-methoxy-3-prop-2-enylbenzimidazol-1-ium-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122417567 |
| Molecular Formula | C26H30N3O6+ |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 2-[[1-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-5-methoxy-3-prop-2-enylbenzimidazol-1-ium-2-yl]methyl]isoindole-1,3-dione |
| SMILES | C=CCn1c(CN2C(=O)c3ccccc3C2=O)[n+](CCOCCOCCO)c2ccc(OC)cc21 |
| InChI | InChI=1S/C26H30N3O6/c1-3-10-27-23-17-19(33-2)8-9-22(23)28(11-13-34-15-16-35-14-12-30)24(27)18-29-25(31)20-6-4-5-7-21(20)26(29)32/h3-9,17,30H,1,10-16,18H2,2H3/q+1 |
| InChIKey | DIIQVONTPMWGEJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|