C32H42IN5O6 — CID 159966880
6-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-N-hexyl-1-(2-hydroxyethyl)-N-methylbenzimidazol-1-ium-5-carboxamide iodide (PubChem CID 159966880) has the molecular formula C32H42IN5O6 and a molecular weight of 719.62 g/mol. Its IUPAC name is 6-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-N-hexyl-1-(2-hydroxyethyl)-N-methylbenzimidazol-1-ium-5-carboxamide iodide.
| Compound Name | 6-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-N-hexyl-1-(2-hydroxyethyl)-N-methylbenzimidazol-1-ium-5-carboxamide iodide |
|---|---|
| PubChem CID | 159966880 |
| Molecular Formula | C32H42IN5O6 |
| Molecular Weight | 719.62 g/mol |
| Exact Mass | 719.22 |
| IUPAC Name | 6-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-N-hexyl-1-(2-hydroxyethyl)-N-methylbenzimidazol-1-ium-5-carboxamide iodide |
| SMILES | CCCCCCN(C)C(=O)c1cc2c(cc1N1C[C@H](O)[C@@H](O)C1)[n+](CCO)c(CN1C(=O)c3ccccc3C1=O)n2CC.[I-] |
| InChI | InChI=1S/C32H42N5O6.HI/c1-4-6-7-10-13-33(3)30(41)23-16-25-26(17-24(23)34-18-27(39)28(40)19-34)36(14-15-38)29(35(25)5-2)20-37-31(42)21-11-8-9-12-22(21)32(37)43;/h8-9,11-12,16-17,27-28,38-40H,4-7,10,13-15,18-20H2,1-3H3;1H/q+1;/p-1/t27-,28-;/m0./s1 |
| InChIKey | FGPLRXIGOLCGQG-DHBRAOIWSA-M |
| XLogP | -1.06 |
| TPSA | 130.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.62 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|