C30H37N5O6 — CID 122420303
6-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-N-hexyl-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide (PubChem CID 122420303) has the molecular formula C30H37N5O6 and a molecular weight of 563.66 g/mol. Its IUPAC name is 6-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-N-hexyl-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide.
| Compound Name | 6-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-N-hexyl-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 122420303 |
| Molecular Formula | C30H37N5O6 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | 6-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-2-[(1,3-dioxoisoindol-2-yl)methyl]-N-hexyl-1-(2-hydroxyethyl)-N-methylbenzimidazole-5-carboxamide |
| SMILES | CCCCCCN(C)C(=O)c1cc2nc(CN3C(=O)c4ccccc4C3=O)n(CCO)c2cc1N1C[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C30H37N5O6/c1-3-4-5-8-11-32(2)28(39)21-14-22-24(15-23(21)33-16-25(37)26(38)17-33)34(12-13-36)27(31-22)18-35-29(40)19-9-6-7-10-20(19)30(35)41/h6-7,9-10,14-15,25-26,36-38H,3-5,8,11-13,16-18H2,1-2H3/t25-,26-/m0/s1 |
| InChIKey | UNRLXDBGJICHEV-UIOOFZCWSA-N |
| XLogP | 2.02 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|