C16H16ClF3IN7OS — CID 53258600
3,5-diamino-6-chloro-N-[[1,3-dimethyl-5-(trifluoromethylsulfanyl)benzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide iodide (PubChem CID 53258600) has the molecular formula C16H16ClF3IN7OS and a molecular weight of 573.77 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[[1,3-dimethyl-5-(trifluoromethylsulfanyl)benzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide iodide.
| Compound Name | 3,5-diamino-6-chloro-N-[[1,3-dimethyl-5-(trifluoromethylsulfanyl)benzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide iodide |
|---|---|
| PubChem CID | 53258600 |
| Molecular Formula | C16H16ClF3IN7OS |
| Molecular Weight | 573.77 g/mol |
| Exact Mass | 572.98 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[[1,3-dimethyl-5-(trifluoromethylsulfanyl)benzimidazol-1-ium-2-yl]methyl]pyrazine-2-carboxamide iodide |
| SMILES | Cn1c(CNC(=O)c2nc(Cl)c(N)nc2N)[n+](C)c2ccc(SC(F)(F)F)cc21.[I-] |
| InChI | InChI=1S/C16H15ClF3N7OS.HI/c1-26-8-4-3-7(29-16(18,19)20)5-9(8)27(2)10(26)6-23-15(28)11-13(21)25-14(22)12(17)24-11;/h3-5H,6H2,1-2H3,(H4-,21,22,23,25,28);1H |
| InChIKey | DFWWTAWXGBPCBE-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.77 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|