C30H26BrN3 — CID 139222248
9-[4-(1-ethyl-3-prop-2-enylbenzimidazol-3-ium-2-yl)phenyl]carbazole bromide (PubChem CID 139222248) has the molecular formula C30H26BrN3 and a molecular weight of 508.46 g/mol. Its IUPAC name is 9-[4-(1-ethyl-3-prop-2-enylbenzimidazol-3-ium-2-yl)phenyl]carbazole bromide.
| Compound Name | 9-[4-(1-ethyl-3-prop-2-enylbenzimidazol-3-ium-2-yl)phenyl]carbazole bromide |
|---|---|
| PubChem CID | 139222248 |
| Molecular Formula | C30H26BrN3 |
| Molecular Weight | 508.46 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 9-[4-(1-ethyl-3-prop-2-enylbenzimidazol-3-ium-2-yl)phenyl]carbazole bromide |
| SMILES | C=CC[n+]1c(-c2ccc(-n3c4ccccc4c4ccccc43)cc2)n(CC)c2ccccc21.[Br-] |
| InChI | InChI=1S/C30H26N3.BrH/c1-3-21-32-29-16-10-9-15-28(29)31(4-2)30(32)22-17-19-23(20-18-22)33-26-13-7-5-11-24(26)25-12-6-8-14-27(25)33;/h3,5-20H,1,4,21H2,2H3;1H/q+1;/p-1 |
| InChIKey | GTPVYRQXKLUNKB-UHFFFAOYSA-M |
| XLogP | 3.90 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|