C21H25ClN2O6 — CID 159399220
1-[3-(1,3-dioxolan-2-yl)propyl]-3-ethyl-2-phenylbenzimidazol-1-ium perchlorate (PubChem CID 159399220) has the molecular formula C21H25ClN2O6 and a molecular weight of 436.89 g/mol. Its IUPAC name is 1-[3-(1,3-dioxolan-2-yl)propyl]-3-ethyl-2-phenylbenzimidazol-1-ium perchlorate.
| Compound Name | 1-[3-(1,3-dioxolan-2-yl)propyl]-3-ethyl-2-phenylbenzimidazol-1-ium perchlorate |
|---|---|
| PubChem CID | 159399220 |
| Molecular Formula | C21H25ClN2O6 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 1-[3-(1,3-dioxolan-2-yl)propyl]-3-ethyl-2-phenylbenzimidazol-1-ium perchlorate |
| SMILES | CCn1c(-c2ccccc2)[n+](CCCC2OCCO2)c2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H25N2O2.ClHO4/c1-2-22-18-11-6-7-12-19(18)23(14-8-13-20-24-15-16-25-20)21(22)17-9-4-3-5-10-17;2-1(3,4)5/h3-7,9-12,20H,2,8,13-16H2,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | LNCYETOXTGPNNS-UHFFFAOYSA-M |
| XLogP | -0.99 |
| TPSA | 119.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|