C18H22N3O+ — CID 3526735
1-ethyl-3-[2-(2-methylphenoxy)ethyl]benzimidazol-3-ium-2-amine (PubChem CID 3526735) has the molecular formula C18H22N3O+ and a molecular weight of 296.39 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-methylphenoxy)ethyl]benzimidazol-3-ium-2-amine.
| Compound Name | 1-ethyl-3-[2-(2-methylphenoxy)ethyl]benzimidazol-3-ium-2-amine |
|---|---|
| PubChem CID | 3526735 |
| Molecular Formula | C18H22N3O+ |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1-ethyl-3-[2-(2-methylphenoxy)ethyl]benzimidazol-3-ium-2-amine |
| SMILES | CCn1c(N)[n+](CCOc2ccccc2C)c2ccccc21 |
| InChI | InChI=1S/C18H21N3O/c1-3-20-15-9-5-6-10-16(15)21(18(20)19)12-13-22-17-11-7-4-8-14(17)2/h4-11,19H,3,12-13H2,1-2H3/p+1 |
| InChIKey | KROXVURCOAOYQU-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 44.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|