C23H33N4O2+ — CID 7045978
(2S)-1-[2-amino-3-[2-(diethylamino)ethyl]benzimidazol-1-ium-1-yl]-3-(2-methylphenoxy)propan-2-ol (PubChem CID 7045978) has the molecular formula C23H33N4O2+ and a molecular weight of 397.54 g/mol. Its IUPAC name is (2S)-1-[2-amino-3-[2-(diethylamino)ethyl]benzimidazol-1-ium-1-yl]-3-(2-methylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-[2-amino-3-[2-(diethylamino)ethyl]benzimidazol-1-ium-1-yl]-3-(2-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 7045978 |
| Molecular Formula | C23H33N4O2+ |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (2S)-1-[2-amino-3-[2-(diethylamino)ethyl]benzimidazol-1-ium-1-yl]-3-(2-methylphenoxy)propan-2-ol |
| SMILES | CCN(CC)CCn1c(N)[n+](C[C@H](O)COc2ccccc2C)c2ccccc21 |
| InChI | InChI=1S/C23H32N4O2/c1-4-25(5-2)14-15-26-20-11-7-8-12-21(20)27(23(26)24)16-19(28)17-29-22-13-9-6-10-18(22)3/h6-13,19,24,28H,4-5,14-17H2,1-3H3/p+1/t19-/m0/s1 |
| InChIKey | QSXDXKQXUFBCJW-IBGZPJMESA-O |
| XLogP | 2.60 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|