C22H31ClN4O+2 — CID 7371915
2-[2-amino-3-[3-(2-chlorophenoxy)propyl]benzimidazol-3-ium-1-yl]ethyl-diethylazanium (PubChem CID 7371915) has the molecular formula C22H31ClN4O+2 and a molecular weight of 402.97 g/mol. Its IUPAC name is 2-[2-amino-3-[3-(2-chlorophenoxy)propyl]benzimidazol-3-ium-1-yl]ethyl-diethylazanium.
| Compound Name | 2-[2-amino-3-[3-(2-chlorophenoxy)propyl]benzimidazol-3-ium-1-yl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7371915 |
| Molecular Formula | C22H31ClN4O+2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-[2-amino-3-[3-(2-chlorophenoxy)propyl]benzimidazol-3-ium-1-yl]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCn1c(N)[n+](CCCOc2ccccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C22H29ClN4O/c1-3-25(4-2)15-16-27-20-12-7-6-11-19(20)26(22(27)24)14-9-17-28-21-13-8-5-10-18(21)23/h5-8,10-13,24H,3-4,9,14-17H2,1-2H3/p+2 |
| InChIKey | HKERHAHBEQVXQL-UHFFFAOYSA-P |
| XLogP | 2.56 |
| TPSA | 48.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|