C20H26N3O2+ — CID 2243537
1-butyl-3-[2-(2-methoxyphenoxy)ethyl]benzimidazol-1-ium-2-amine (PubChem CID 2243537) has the molecular formula C20H26N3O2+ and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-butyl-3-[2-(2-methoxyphenoxy)ethyl]benzimidazol-1-ium-2-amine.
| Compound Name | 1-butyl-3-[2-(2-methoxyphenoxy)ethyl]benzimidazol-1-ium-2-amine |
|---|---|
| PubChem CID | 2243537 |
| Molecular Formula | C20H26N3O2+ |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-butyl-3-[2-(2-methoxyphenoxy)ethyl]benzimidazol-1-ium-2-amine |
| SMILES | CCCC[n+]1c(N)n(CCOc2ccccc2OC)c2ccccc21 |
| InChI | InChI=1S/C20H25N3O2/c1-3-4-13-22-16-9-5-6-10-17(16)23(20(22)21)14-15-25-19-12-8-7-11-18(19)24-2/h5-12,21H,3-4,13-15H2,1-2H3/p+1 |
| InChIKey | SKEYWFVHTUBBHY-UHFFFAOYSA-O |
| XLogP | 3.40 |
| TPSA | 53.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|