C21H27Cl2N4O+ — CID 7372150
1-[2-(2,4-dichlorophenoxy)ethyl]-3-[2-(diethylamino)ethyl]benzimidazol-3-ium-2-amine (PubChem CID 7372150) has the molecular formula C21H27Cl2N4O+ and a molecular weight of 422.38 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenoxy)ethyl]-3-[2-(diethylamino)ethyl]benzimidazol-3-ium-2-amine.
| Compound Name | 1-[2-(2,4-dichlorophenoxy)ethyl]-3-[2-(diethylamino)ethyl]benzimidazol-3-ium-2-amine |
|---|---|
| PubChem CID | 7372150 |
| Molecular Formula | C21H27Cl2N4O+ |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 1-[2-(2,4-dichlorophenoxy)ethyl]-3-[2-(diethylamino)ethyl]benzimidazol-3-ium-2-amine |
| SMILES | CCN(CC)CC[n+]1c(N)n(CCOc2ccc(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C21H26Cl2N4O/c1-3-25(4-2)11-12-26-18-7-5-6-8-19(18)27(21(26)24)13-14-28-20-10-9-16(22)15-17(20)23/h5-10,15,24H,3-4,11-14H2,1-2H3/p+1 |
| InChIKey | UDSOWXUMLKEPCZ-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 47.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|