C17H15Cl2N2O+ — CID 8855117
1-[2-(2,4-dichlorophenoxy)ethyl]-3-ethenylbenzimidazol-1-ium (PubChem CID 8855117) has the molecular formula C17H15Cl2N2O+ and a molecular weight of 334.23 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenoxy)ethyl]-3-ethenylbenzimidazol-1-ium.
| Compound Name | 1-[2-(2,4-dichlorophenoxy)ethyl]-3-ethenylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 8855117 |
| Molecular Formula | C17H15Cl2N2O+ |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-[2-(2,4-dichlorophenoxy)ethyl]-3-ethenylbenzimidazol-1-ium |
| SMILES | C=Cn1c[n+](CCOc2ccc(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C17H15Cl2N2O/c1-2-20-12-21(16-6-4-3-5-15(16)20)9-10-22-17-8-7-13(18)11-14(17)19/h2-8,11-12H,1,9-10H2/q+1 |
| InChIKey | GUNWTFNFYSUGTP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|