C11H11Cl2NO — CID 82085345
3-(2,4-dichlorophenoxy)-2,2-dimethylpropanenitrile (PubChem CID 82085345) has the molecular formula C11H11Cl2NO and a molecular weight of 244.12 g/mol. Its IUPAC name is 3-(2,4-dichlorophenoxy)-2,2-dimethylpropanenitrile.
| Compound Name | 3-(2,4-dichlorophenoxy)-2,2-dimethylpropanenitrile |
|---|---|
| PubChem CID | 82085345 |
| Molecular Formula | C11H11Cl2NO |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 3-(2,4-dichlorophenoxy)-2,2-dimethylpropanenitrile |
| SMILES | CC(C)(C#N)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2NO/c1-11(2,6-14)7-15-10-4-3-8(12)5-9(10)13/h3-5H,7H2,1-2H3 |
| InChIKey | HAOAUBLQBNGHOC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |