C22H31BrN4O2 — CID 163331972
1-[2-(diethylamino)ethyl]-3-[2-(4-methoxyphenoxy)ethyl]benzimidazol-1-ium-2-amine bromide (PubChem CID 163331972) has the molecular formula C22H31BrN4O2 and a molecular weight of 463.42 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-[2-(4-methoxyphenoxy)ethyl]benzimidazol-1-ium-2-amine bromide.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-[2-(4-methoxyphenoxy)ethyl]benzimidazol-1-ium-2-amine bromide |
|---|---|
| PubChem CID | 163331972 |
| Molecular Formula | C22H31BrN4O2 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-[2-(4-methoxyphenoxy)ethyl]benzimidazol-1-ium-2-amine bromide |
| SMILES | CCN(CC)CC[n+]1c(N)n(CCOc2ccc(OC)cc2)c2ccccc21.[Br-] |
| InChI | InChI=1S/C22H30N4O2.BrH/c1-4-24(5-2)14-15-25-20-8-6-7-9-21(20)26(22(25)23)16-17-28-19-12-10-18(27-3)11-13-19;/h6-13,23H,4-5,14-17H2,1-3H3;1H |
| InChIKey | ILFFWJLICSNMDK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 56.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|