C15H25N4O+ — CID 6945076
2-[2-amino-3-[2-(diethylamino)ethyl]benzimidazol-3-ium-1-yl]ethanol (PubChem CID 6945076) has the molecular formula C15H25N4O+ and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[2-amino-3-[2-(diethylamino)ethyl]benzimidazol-3-ium-1-yl]ethanol.
| Compound Name | 2-[2-amino-3-[2-(diethylamino)ethyl]benzimidazol-3-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 6945076 |
| Molecular Formula | C15H25N4O+ |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-[2-amino-3-[2-(diethylamino)ethyl]benzimidazol-3-ium-1-yl]ethanol |
| SMILES | CCN(CC)CC[n+]1c(N)n(CCO)c2ccccc21 |
| InChI | InChI=1S/C15H24N4O/c1-3-17(4-2)9-10-18-13-7-5-6-8-14(13)19(11-12-20)15(18)16/h5-8,16,20H,3-4,9-12H2,1-2H3/p+1 |
| InChIKey | MZQWKMKJXAYBAS-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 58.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|