C20H27N3O5S — CID 163333823
1-[(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-2-indol-1-ylethanone;acetic acid (PubChem CID 163333823) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-[(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-2-indol-1-ylethanone;acetic acid.
| Compound Name | 1-[(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-2-indol-1-ylethanone;acetic acid |
|---|---|
| PubChem CID | 163333823 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 1-[(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-2-indol-1-ylethanone;acetic acid |
| SMILES | CC(=O)O.CN(C)[C@@H]1CS(=O)(=O)[C@H]2CN(C(=O)Cn3ccc4ccccc43)C[C@@H]12 |
| InChI | InChI=1S/C18H23N3O3S.C2H4O2/c1-19(2)16-12-25(23,24)17-10-21(9-14(16)17)18(22)11-20-8-7-13-5-3-4-6-15(13)20;1-2(3)4/h3-8,14,16-17H,9-12H2,1-2H3;1H3,(H,3,4)/t14-,16+,17-;/m0./s1 |
| InChIKey | DXTMRGJLSJOVAG-XAUMKULISA-N |
| XLogP | 0.92 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |