C23H33N3O4 — CID 172912030
1-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(1-methylindol-3-yl)ethanone;formic acid (PubChem CID 172912030) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is 1-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(1-methylindol-3-yl)ethanone;formic acid.
| Compound Name | 1-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(1-methylindol-3-yl)ethanone;formic acid |
|---|---|
| PubChem CID | 172912030 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 1-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(1-methylindol-3-yl)ethanone;formic acid |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)Cc3cn(C)c4ccccc34)C[C@H]2C[C@H]1N(C)C.O=CO |
| InChI | InChI=1S/C22H31N3O2.CH2O2/c1-23(2)20-9-15-13-25(14-16(15)10-21(20)27-4)22(26)11-17-12-24(3)19-8-6-5-7-18(17)19;2-1-3/h5-8,12,15-16,20-21H,9-11,13-14H2,1-4H3;1H,(H,2,3)/t15-,16+,20-,21-;/m1./s1 |
| InChIKey | UWQYOVMZOYWAMO-QIYIGXHASA-N |
| XLogP | 2.24 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|