C19H30N4O5S — CID 172910225
2-[2-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]sulfanyl-4-methyl-1H-pyrimidin-6-one;formic acid (PubChem CID 172910225) has the molecular formula C19H30N4O5S and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-[2-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]sulfanyl-4-methyl-1H-pyrimidin-6-one;formic acid.
| Compound Name | 2-[2-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]sulfanyl-4-methyl-1H-pyrimidin-6-one;formic acid |
|---|---|
| PubChem CID | 172910225 |
| Molecular Formula | C19H30N4O5S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-[2-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-oxoethyl]sulfanyl-4-methyl-1H-pyrimidin-6-one;formic acid |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)CSc3nc(C)cc(=O)[nH]3)C[C@H]2C[C@H]1N(C)C.O=CO |
| InChI | InChI=1S/C18H28N4O3S.CH2O2/c1-11-5-16(23)20-18(19-11)26-10-17(24)22-8-12-6-14(21(2)3)15(25-4)7-13(12)9-22;2-1-3/h5,12-15H,6-10H2,1-4H3,(H,19,20,23);1H,(H,2,3)/t12-,13+,14-,15-;/m1./s1 |
| InChIKey | YUJVJBOAFGEMDG-XKKAXVAMSA-N |
| XLogP | 0.68 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|