C26H41N3O5 — CID 172910778
4-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(2-tert-butylphenyl)-4-oxobutanamide;formic acid (PubChem CID 172910778) has the molecular formula C26H41N3O5 and a molecular weight of 475.63 g/mol. Its IUPAC name is 4-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(2-tert-butylphenyl)-4-oxobutanamide;formic acid.
| Compound Name | 4-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(2-tert-butylphenyl)-4-oxobutanamide;formic acid |
|---|---|
| PubChem CID | 172910778 |
| Molecular Formula | C26H41N3O5 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | 4-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(2-tert-butylphenyl)-4-oxobutanamide;formic acid |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)CCC(=O)Nc3ccccc3C(C)(C)C)C[C@H]2C[C@H]1N(C)C.O=CO |
| InChI | InChI=1S/C25H39N3O3.CH2O2/c1-25(2,3)19-9-7-8-10-20(19)26-23(29)11-12-24(30)28-15-17-13-21(27(4)5)22(31-6)14-18(17)16-28;2-1-3/h7-10,17-18,21-22H,11-16H2,1-6H3,(H,26,29);1H,(H,2,3)/t17-,18+,21-,22-;/m1./s1 |
| InChIKey | CFCYPXYTNZGANJ-QIIUWFAASA-N |
| XLogP | 3.22 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|