C19H31N3O5 — CID 172910554
[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-ethyl-5-methyl-1,2-oxazol-4-yl)methanone;formic acid (PubChem CID 172910554) has the molecular formula C19H31N3O5 and a molecular weight of 381.47 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-ethyl-5-methyl-1,2-oxazol-4-yl)methanone;formic acid.
| Compound Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-ethyl-5-methyl-1,2-oxazol-4-yl)methanone;formic acid |
|---|---|
| PubChem CID | 172910554 |
| Molecular Formula | C19H31N3O5 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-ethyl-5-methyl-1,2-oxazol-4-yl)methanone;formic acid |
| SMILES | CCc1noc(C)c1C(=O)N1C[C@H]2C[C@@H](N(C)C)[C@H](OC)C[C@H]2C1.O=CO |
| InChI | InChI=1S/C18H29N3O3.CH2O2/c1-6-14-17(11(2)24-19-14)18(22)21-9-12-7-15(20(3)4)16(23-5)8-13(12)10-21;2-1-3/h12-13,15-16H,6-10H2,1-5H3;1H,(H,2,3)/t12-,13+,15-,16-;/m1./s1 |
| InChIKey | NPTWGXSUNKIFEW-FPQFZXIPSA-N |
| XLogP | 1.67 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|