C19H27N5O4 — CID 172911322
[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-pyrazolo[5,4-b]pyridin-6-yl)methanone;formic acid (PubChem CID 172911322) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-pyrazolo[5,4-b]pyridin-6-yl)methanone;formic acid.
| Compound Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-pyrazolo[5,4-b]pyridin-6-yl)methanone;formic acid |
|---|---|
| PubChem CID | 172911322 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1H-pyrazolo[5,4-b]pyridin-6-yl)methanone;formic acid |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)c3ccc4cn[nH]c4n3)C[C@H]2C[C@H]1N(C)C.O=CO |
| InChI | InChI=1S/C18H25N5O2.CH2O2/c1-22(2)15-6-12-9-23(10-13(12)7-16(15)25-3)18(24)14-5-4-11-8-19-21-17(11)20-14;2-1-3/h4-5,8,12-13,15-16H,6-7,9-10H2,1-3H3,(H,19,20,21);1H,(H,2,3)/t12-,13+,15-,16-;/m1./s1 |
| InChIKey | XJNBUMFOZLAWNS-FPQFZXIPSA-N |
| XLogP | 1.09 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|