C26H39N3O5 — CID 172910392
[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[1-(2-methylbenzoyl)piperidin-4-yl]methanone;formic acid (PubChem CID 172910392) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[1-(2-methylbenzoyl)piperidin-4-yl]methanone;formic acid.
| Compound Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[1-(2-methylbenzoyl)piperidin-4-yl]methanone;formic acid |
|---|---|
| PubChem CID | 172910392 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[1-(2-methylbenzoyl)piperidin-4-yl]methanone;formic acid |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)C3CCN(C(=O)c4ccccc4C)CC3)C[C@H]2C[C@H]1N(C)C.O=CO |
| InChI | InChI=1S/C25H37N3O3.CH2O2/c1-17-7-5-6-8-21(17)25(30)27-11-9-18(10-12-27)24(29)28-15-19-13-22(26(2)3)23(31-4)14-20(19)16-28;2-1-3/h5-8,18-20,22-23H,9-16H2,1-4H3;1H,(H,2,3)/t19-,20+,22-,23-;/m1./s1 |
| InChIKey | ZZLKXWONEIAUJJ-FLIRWYAISA-N |
| XLogP | 2.36 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|